| Identification | |
| Name: | 2-Methylbutane |
| Synonyms: | Isopentane; ISO-PENTANE |
| CAS: | 78-78-4 |
| EINECS: | 201-142-8 |
| Molecular Formula: | C5H12 |
| Molecular Weight: | 72.15 |
| InChI: | InChI=1/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1265 |
| Density: | 0.62 |
| Stability: | Stable. Extremely flammable. Incompatible with strong oxidizing agents. Vapour-air mixtures explosive in certain proportions. Incompatible with rubber, various plastics. The vapour, being heavier than air, may roll over surfaces and collect in low points. Note low flash point. |
| Refractive index: | 1.353-1.55 |
| Solubility: | Miscible in alcohol and ether Soluble in hydrocarbons, oils In water, 48 mg/L at 25 deg C |
| Appearance: | colourless liquid with a characteristic smell |
| Specification: |
?Isopentane , with CAS number of 78-78-4, can be called 1,1,2-Trimethylethane ; 1,1-dimethylpropane ; 2Methylbutan ; 2-methyl-butan ; Butane,2-methy- ; dimethylethylmethane ; Ethyldimethylmethane ; Exxsol isopentane . Isopentane (CAS NO.78-78-4) can be used as a solvent of polyethylene, also can be made of polystyrene foam, polyurethane foam system, foam, solvent de-asphalting. It is a low toxic, flammable liquids, burning will produce irritation of smoke, need to store in the cold and dry environment, and stored separately with oxidants and acids. dry powder, dry sand, carbon dioxide, foam can be used if something urgent happened. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I |
| Color: | Volatile liquid or gas |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
