| Identification | |
| Name: | Isoprene |
| Synonyms: | 2-Methyl-1,3-butadiene; Isoprene (99%+) |
| CAS: | 78-79-5 |
| EINECS: | 201-143-3 |
| Molecular Formula: | C5H8 |
| Molecular Weight: | 68.12 |
| InChI: | InChI=1/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1218 |
| Density: | 0.68 |
| Stability: | Stability Extremely flammable. Readily forms explosive mixtures with air. Note low flash point, low boiling point, high vapour pressure. Unstable - prone to spontaneous polymerization. May contain a polymerization inhibitor. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4205-1.4225 |
| Water Solubility: | 0.07 g/100 mL |
| Solubility: | 0.07 g/100 mL in water |
| Appearance: | colourless liquid with an aromatic odour |
| Specification: | colourless liquid with an aromatic odour Safety Statements:53-45-61 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | I |
| Storage Temperature: | 2-8°C |
| Color: | Colorless volatile liquid |
| Safety Data | |
| Hazard Symbols |
F+:Highlyflammable
T:Toxic
|
 |
|
