| Identification |
| Name: | 2-Chlorobutane |
| Synonyms: | Chlorobutane, 2- Sec-butyl chloride; (2RS)-chlorobutane; 1-Methylpropyl chloride; 1-methylpropylchloride; 2-Butylchloride; 2-Chlorbutan; 2-Chloro-3-methylpropane; 2-chloro-butan; Butane,2-chloro- |
| CAS: | 78-86-4 |
| EINECS: | 201-151-7 |
| Molecular Formula: | C4H9Cl |
| Molecular Weight: | 92.56 |
| InChI: | InChI=1/C4H9Cl/c1-3-4(2)5/h4H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1127 |
| Density: | 0.87 |
| Stability: | Stable. Flammable - note low flash point. May form explosive mixtures with air. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.396-1.398 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| HS Code: | 29031980 |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
F:Flammable
|
| |
 |
