| Identification | |
| Name: | 1,1-DICHLOROPROPANE |
| Synonyms: | PROPYLIDENE CHLORIDE;1,1-dichloro-propan;alpha,alpha-dichloropropane;alpha,alpha-propylenedichloride;dichloro-1,1propane;propane,1,1-dichloro;propane,1,1-dichloro-;r270fb |
| CAS: | 78-99-9 |
| EINECS: | 201-165-3 |
| Molecular Formula: | C3H6Cl2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C3H6Cl2/c1-2-3(4)5/h3H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 2 |
| Flash Point: | 45 °F |
| Boiling Point: | 88 °C(lit.) |
| Density: | 1.13 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.4275(lit.) |
| Solubility: | Sol in alcohol, ether, benzene, chloroform Very slightly sol in water; sol in many org solvents In water, 2,700 mg/l @ 20 deg C. |
| Specification: | Safety Statements:16-26-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 45 °F |
| Color: | Liquid |
| Safety Data | |
 |
|
