| Identification | |
| Name: | 1H-Purine-2,6-dione,3,9-dihydro-8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)- |
| Synonyms: | 1H-Purine-2,6-dione,3,7-dihydro-8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)- (9CI);1-Methyl-3-isobutyl-8-methoxymethylxanthine;8-Methoxymethyl-3-isobutyl-1-methylxanthine; MMPX |
| CAS: | 78033-08-6 |
| Molecular Formula: | C12H18 N4 O3 |
| Molecular Weight: | 266.3 |
| InChI: | InChI=1/C12H18N4O3/c1-7(2)5-16-10-9(11(17)15(3)12(16)18)13-8(14-10)6-19-4/h7H,5-6H2,1-4H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 241.9°C |
| Boiling Point: | 476.4°C at 760 mmHg |
| Density: | 1.249g/cm3 |
| Refractive index: | 1.554 |
| Specification: | White Crystalline Solid usageEng:A specific inhibitor of calmodulin-sensitive cyclic GMP phosphodiesterase |
| Biological Activity: | Specific inhibitor of calmodulin-sensitive cyclic GMP phosphodiesterase (IC 50 = 5.2 μ M). |
| Flash Point: | 241.9°C |
| Storage Temperature: | Store at RT |
| Usage: | A specific inhibitor of calmodulin-sensitive cyclic GMP phosphodiesterase |
| Safety Data | |
 |
|
