Identification |
Name: | 1H-Purine-2,6-dione,3,9-dihydro-8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)- |
Synonyms: | 1H-Purine-2,6-dione,3,7-dihydro-8-(methoxymethyl)-1-methyl-3-(2-methylpropyl)- (9CI);1-Methyl-3-isobutyl-8-methoxymethylxanthine;8-Methoxymethyl-3-isobutyl-1-methylxanthine; MMPX |
CAS: | 78033-08-6 |
Molecular Formula: | C12H18 N4 O3 |
Molecular Weight: | 266.3 |
InChI: | InChI=1/C12H18N4O3/c1-7(2)5-16-10-9(11(17)15(3)12(16)18)13-8(14-10)6-19-4/h7H,5-6H2,1-4H3,(H,13,14) |
Molecular Structure: |
 |
Properties |
Flash Point: | 241.9°C |
Boiling Point: | 476.4°C at 760 mmHg |
Density: | 1.249g/cm3 |
Refractive index: | 1.554 |
Specification: | White Crystalline Solid usageEng:A specific inhibitor of calmodulin-sensitive cyclic GMP phosphodiesterase |
Biological Activity: | Specific inhibitor of calmodulin-sensitive cyclic GMP phosphodiesterase (IC 50 = 5.2 μ M). |
Flash Point: | 241.9°C |
Storage Temperature: | Store at RT |
Usage: | A specific inhibitor of calmodulin-sensitive cyclic GMP phosphodiesterase |
Safety Data |
|
 |