| Identification | |
| Name: | 6'-Chloro-3-(2-methylpiperidino)-o-propionotoluidide hydrochloride |
| Synonyms: | C 3139;6'-Chloro-3-(2-methylpiperidino)-o-propionotoluidide hydrochloride;o-Propionotoluidide, 6'-chloro-3-(2-methylpiperidino)-, hydrochloride;AC1MHZTU;LS-124989;N-(2-chloro-6-methylphenyl)-3-(2-methylpiperidin-1-yl)propanamide hydrochloride;78218-42-5 |
| CAS: | 78218-42-5 |
| Molecular Formula: | C16H23ClN2O . ClH |
| Molecular Weight: | 331.2806 |
| InChI: | InChI=1/C16H23ClN2O.ClH/c1-12-6-5-8-14(17)16(12)18-15(20)9-11-19-10-4-3-7-13(19)2;/h5-6,8,13H,3-4,7,9-11H2,1-2H3,(H,18,20);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220.6°C |
| Boiling Point: | 441.1°C at 760 mmHg |
| Specification: |
6'-Chloro-3-(2-methylpiperidino)-o-propionotoluidide hydrochloride , its cas register number is 78218-42-5. It also can be called o-Propionotoluidide, 6'-chloro-3-(2-methylpiperidino)-, hydrochloride . Its classification code are Drug / Therapeutic Agent and Skin / Eye Irritant. |
| Flash Point: | 220.6°C |
| Safety Data | |
 |
|
