| Identification | |
| Name: | Propanamide,N-butyl-2-(butylamino)-N-(2,6-dimethylphenyl)-, hydrochloride (1:1) |
| Synonyms: | Propanamide,N-butyl-2-(butylamino)-N-(2,6-dimethylphenyl)-, monohydrochloride (9CI) |
| CAS: | 78218-43-6 |
| Molecular Formula: | C19H32 N2 O . Cl H |
| Molecular Weight: | 340.99 |
| InChI: | InChI=1/C19H32N2O.ClH/c1-6-8-13-20-17(5)19(22)21(14-9-7-2)18-15(3)11-10-12-16(18)4;/h10-12,17,20H,6-9,13-14H2,1-5H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 210.5°C |
| Boiling Point: | 424.4°C at 760 mmHg |
| Specification: |
N-Butyl-2-(butylamino)-2',6'-propionoxylidide hydrochloride , its cas register number is 78218-43-6. It also can be called C 3160 ; 2',6'-Propionoxylidide, N-butyl-2-(butylamino)-, hydrochloride . And N-Butyl-2-(butylamino)-2',6'-propionoxylidide hydrochloride (CAS NO.78218-43-6) will cause a severe eye irritant. When heated to decomposition it emits very toxic fumes of HCl and NOx. |
| Flash Point: | 210.5°C |
| Safety Data | |
 |
|
