| Identification | |
| Name: | Hexanamide,2-(butylamino)-N-(2-chloro-6-methylphenyl)-, hydrochloride (1:1) |
| Synonyms: | Hexanamide,2-(butylamino)-N-(2-chloro-6-methylphenyl)-, monohydrochloride (9CI);o-Hexanotoluidide, 2-butylamino-6'-chloro-, hydrochloride (6CI) |
| CAS: | 78265-89-1 |
| Molecular Formula: | C17H27 Cl N2 O . Cl H |
| Molecular Weight: | 347.37 |
| InChI: | InChI=1/C17H27ClN2O.ClH/c1-4-6-11-15(19-12-7-5-2)17(21)20-16-13(3)9-8-10-14(16)18;/h8-10,15,19H,4-7,11-12H2,1-3H3,(H,20,21);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 217.4°C |
| Boiling Point: | 435.9°C at 760 mmHg |
| Specification: |
C 3207 (CAS NO.78265-89-1) is also named as 2-(Butylamino)-6'-chloro-o-hexanotoluidide hydrochloride ; o-Hexanotoluidide, 2-(butylamino)-6'-chloro-, hydrochloride . C 3207 (CAS NO.78265-89-1) is high toxic. It will produce toxic nitrogen oxides and chlorine fumes by heat. So the storage environment should be ventilate, low-temperature and dry. Keep C 3207 (CAS NO.78265-89-1) separate from raw materials of food. |
| Flash Point: | 217.4°C |
| Safety Data | |
 |
|
