| Identification | |
| Name: | 1-Pyrrolidineacetamide,a-butyl-N-(2-chloro-6-methylphenyl)-,hydrochloride (1:1) |
| Synonyms: | 1-Pyrrolidineacetamide,a-butyl-N-(2-chloro-6-methylphenyl)-,monohydrochloride (9CI); 1-Pyrrolidineaceto-o-toluidide, a-butyl-6'-chloro-, hydrochloride(6CI) |
| CAS: | 78265-91-5 |
| Molecular Formula: | C17H25 Cl N2 O . Cl H |
| Molecular Weight: | 361.35 |
| InChI: | InChI=1/C17H25ClN2O.ClH/c1-3-4-10-15(20-11-5-6-12-20)17(21)19-16-13(2)8-7-9-14(16)18;/h7-9,15H,3-6,10-12H2,1-2H3,(H,19,21);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 219.8°C |
| Boiling Point: | 439.9°C at 760 mmHg |
| Specification: |
C 3206 (CAS NO.78265-91-5) is also called 6'-Chloro-2-pyrrolidinyl-o-hexanotoluidide hydrochloride ; o-Hexanotoluidide, 6'-chloro-2-pyrrolidinyl-, hydrochloride . C 3206 (CAS NO.78265-91-5) is high toxic. It will produce toxic nitrogen oxides and chlorine fumes by heat. So the storage environment should be ventilate, low-temperature and dry. Keep C 3206 (CAS NO.78265-91-5) separate from raw materials of food. |
| Flash Point: | 219.8°C |
| Safety Data | |
 |
|
