| Identification | |
| Name: | 2,5-Cyclohexadien-1-one,5-amino-4-[(4-aminomethylphenyl)imino]-2-methoxy- (9CI) |
| Synonyms: | 5-Amino-4-((4-aminomethylphenyl)imino)-2-methoxy-2,5-cyclohexadien-1-o ne |
| CAS: | 78279-14-8 |
| Molecular Formula: | C14H15 N3 O2 |
| Molecular Weight: | 257.32 |
| InChI: | InChI=1/C14H15N3O2/c1-19-14-7-12(11(16)6-13(14)18)17-10-4-2-9(8-15)3-5-10/h2-7H,8,15-16H2,1H3/b17-12+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 218.5°C |
| Boiling Point: | 437.6°C at 760 mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.618 |
| Specification: |
2-Amino-5-methoxy-2'(or 3')-methylindoaniline ,its cas register number is 78279-14-8. It also can be called 5-Amino-4-((4-aminomethylphenyl)imino)-2-methoxy-2,5-cyclohexadien-1-one ; and 2,5-Cyclohexadien-1-one, 5-amino-4-((4-aminomethylphenyl)imino)-2-methoxy- . |
| Flash Point: | 218.5°C |
| Safety Data | |
 |
|
