| Identification | |
| Name: | Ethyl 3-((diethylamino)methyl)-4-hydroxybenzoate |
| Synonyms: | BRN 3034053;Ethyl 3-((diethylamino)methyl)-4-hydroxybenzoate;3-((Diethylamino)methyl)-4-hydroxybenzoic acid ethyl ester;BENZOIC ACID, 3-(DIETHYLAMINO)METHYL-4-HYDROXY-, ETHYL ESTER;78329-97-2;AC1L1GIC;LS-36951;ethyl 3-(diethylaminomethyl)-4-hydroxybenzoate |
| CAS: | 78329-97-2 |
| Molecular Formula: | C14H21NO3 |
| Molecular Weight: | 251.3214 |
| InChI: | InChI=1/C14H21NO3/c1-4-15(5-2)10-12-9-11(7-8-13(12)16)14(17)18-6-3/h7-9,16H,4-6,10H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 171.1°C |
| Boiling Point: | 359.3°C at 760 mmHg |
| Density: | 1.083g/cm3 |
| Refractive index: | 1.53 |
| Specification: |
Ethyl 3-((diethylamino)methyl)-4-hydroxybenzoate , its cas register number is 78329-97-2. It also can be called 3-((Diethylamino)methyl)-4-hydroxybenzoic acid ethyl ester ; BRN 3034053 . When Ethyl 3-((diethylamino)methyl)-4-hydroxybenzoate (CAS NO.78329-97-2) is heated to decomposition, it emits toxic fumes of NOx. |
| Flash Point: | 171.1°C |
| Safety Data | |
 |
|
