| Identification | |
| Name: | Ethyl 4-hydroxy-3-morpholinomethylbenzoate |
| Synonyms: | 4-Hydroxy-3-morpholinomethylbenzoic acid ethyl ester;Ethyl 4-hydroxy-3-morpholinomethylbenzoate;ethyl 4-hydroxy-3-(morpholin-4-ylmethyl)benzoate;BENZOIC ACID, 4-HYDROXY-3-MORPHOLINOMETHYL-, ETHYL ESTER;78330-02-6;AC1L1GII;LS-37642 |
| CAS: | 78330-02-6 |
| Molecular Formula: | C13H19NO4 |
| Molecular Weight: | 265.305 |
| InChI: | InChI=1/C14H19NO4/c1-2-19-14(17)11-3-4-13(16)12(9-11)10-15-5-7-18-8-6-15/h3-4,9,16H,2,5-8,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 199.9°C |
| Boiling Point: | 407°C at 760 mmHg |
| Density: | 1.207g/cm3 |
| Refractive index: | 1.56 |
| Specification: |
Ethyl 4-hydroxy-3-morpholinomethylbenzoate , its cas register number is 78330-02-6. It also can be called 4-Hydroxy-3-morpholinomethylbenzoic acid ethyl ester ; Benzoic acid, 4-hydroxy-3-morpholinomethyl-, ethyl ester . When Ethyl 4-hydroxy-3-morpholinomethylbenzoate (CAS NO.78330-02-6) is heated to decomposition, it emits toxic fumes of NOx. |
| Flash Point: | 199.9°C |
| Safety Data | |
 |
|
