| Identification | |
| Name: | 2H-Pyran-4-ol,4-(aminomethyl)tetrahydro- |
| Synonyms: | 4-(Aminomethyl)tetrahydro-2H-pyran-4-ol;4-Aminomethyltetrahydropyran-4-ol; |
| CAS: | 783303-73-1 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 130.17 |
| InChI: | InChI=1/C6H13NO2/c7-5-6(8)1-3-9-4-2-6/h8H,1-5,7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.115 g/cm3 |
| Refractive index: | 1.496 |
| Specification: |
The 4-(Aminomethyl)tetrahydro-2H-pyran-4-ol, with cas registry number 783303-73-1, has the systematic name of 4-(aminomethyl)tetrahydropyran-4-ol. And it is also called 2H-pyran-4-ol, 4-(aminomethyl)tetrahydro-. Physical properties about this chemical are: (1)# of Rule of 5 Violations: 0; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 3; (7)#H bond donors: 3; (8)#Freely Rotating Bonds: 3; (9)Polar Surface Area: 55.48 Å2; (10)Index of Refraction: 1.496; (11)Molar Refractivity: 34.389 cm3; (12)Molar Volume: 117.658 cm3; (13)Polarizability: 13.633×10-24cm3; (14)Surface Tension: 47.756 dyne/cm; (15)Enthalpy of Vaporization: 57.646 kJ/mol; (16)Vapour Pressure: 0.002 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
