| Identification | |
| Name: | 2(5H)-Furanone,5-(hydroxymethyl)-, (5S)- |
| Synonyms: | 2(5H)-Furanone,5-(hydroxymethyl)-, (S)-;(5S)-Hydroxymethyl-5H-furan-2-one;(S)-(-)-5-(Hydroxymethyl)-2(5H)furanone;(S)-5-(Hydroxymethyl)furan-2(5H)-one;(S)-5-Hydroxy-2-penten-4-olide;l-Ranunculin aglycon; |
| CAS: | 78508-96-0 |
| Molecular Formula: | C5H6O3 |
| Molecular Weight: | 114.0993 |
| InChI: | InChI=1S/C5H6O3/c6-3-4-1-2-5(7)8-4/h1-2,4,6H,3H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 41-43ºC(lit.) |
| Flash Point: | 113 ºC |
| Boiling Point: | 334.8 ºC at 760 mmHg |
| Density: | 1.294 g/cm3 |
| Refractive index: | 1.502 |
| Specification: |
The (S)-(-)-5-Hydroxymethyl-2(5H)-furanone, with the CAS registry number 78508-96-0, has the systematic name of (5S)-5-(hydroxymethyl)furan-2(5H)-one. It belongs to the following product categories: Chiral Reagent; Chiral Building Blocks; Furans; Heterocyclic Building Blocks. And the molecular formula of the chemical is C5H6O3. What's more, while dealing with this chemical, you should avoid contact with skin and eyes. The characteristics of (S)-(-)-5-Hydroxymethyl-2(5H)-furanone are as followings: (1)ACD/LogP: -1.92; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 46.53 Å2; (7)Index of Refraction: 1.502; (8)Molar Refractivity: 26.015 cm3; (9)Molar Volume: 88.121 cm3; (10)Polarizability: 10.313×10-24cm3; (11)Surface Tension: 45.369 dyne/cm; (12)Density: 1.295 g/cm3; (13)Flash Point: 166.808 °C; (14)Enthalpy of Vaporization: 66.937 kJ/mol; (15)Boiling Point: 334.754 °C at 760 mmHg; (16)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 113 ºC |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
