Identification |
Name: | 10H-Thieno[2,3-b][1,5]benzodiazepine,2-methyl-4-[4-(methyl-d3)-1-piperazinyl]- (9CI) |
Synonyms: | OLANZAPINE-METHYL-D3;2-Methyl-4-(4-methyl-d3-1-piperazinyl)-10H-thieno[2,3-b][1,5]benzodiazepine |
CAS: | 786686-79-1 |
Molecular Formula: | C17H17 D3 N4 S |
Molecular Weight: | 315.45 |
InChI: | InChI=1/C17H20N4S/c1-12-11-13-16(21-9-7-20(2)8-10-21)18-14-5-3-4-6-15(14)19-17(13)22-12/h3-6,11,19H,7-10H2,1-2H3/i2D3 |
Molecular Structure: |
|
Properties |
Flash Point: | 241.697°C |
Boiling Point: | 476.035°C at 760 mmHg |
Density: | 1.337g/cm3 |
Refractive index: | 1.709 |
Specification: | Yellow to Brown Solid usageEng:Deuterated Olanzapine, a serotonin (5-HT2) and dopamine (D1/D2) receptor antagonist with anticholinergic activity. Antipsychotic. |
Flash Point: | 241.697°C |
Usage: | Deuterated Olanzapine, a serotonin (5-HT2) and dopamine (D1/D2) receptor antagonist with anticholinergic activity |
Safety Data |
|
|