Identification |
Name: | 3-Pyridinecarbonylchloride, 2,5-dichloro- |
Synonyms: | 2,5-Dichloronicotinoylchloride; 2,5-Dichloropyridine-3-carbonyl chloride |
CAS: | 78686-87-0 |
Molecular Formula: | C6H2 Cl3 N O |
Molecular Weight: | 210.45 |
InChI: | InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
Molecular Structure: |
![(C6H2Cl3NO) 2,5-Dichloronicotinoylchloride; 2,5-Dichloropyridine-3-carbonyl chloride](https://img1.guidechem.com/chem/e/dict/57/78686-87-0.jpg) |
Properties |
Transport: | 3265 |
Density: | 1.582g/cm3 |
Refractive index: | 1.582 |
Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Safety Data |
Hazard Symbols |
C: Corrosive
|
|
![](/images/detail_15.png) |