| Identification | |
| Name: | 3-Pyridinecarbonylchloride, 2,5-dichloro- |
| Synonyms: | 2,5-Dichloronicotinoylchloride; 2,5-Dichloropyridine-3-carbonyl chloride |
| CAS: | 78686-87-0 |
| Molecular Formula: | C6H2 Cl3 N O |
| Molecular Weight: | 210.45 |
| InChI: | InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Density: | 1.582g/cm3 |
| Refractive index: | 1.582 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
