| Identification | |
| Name: | Acetaldehyde,2,2-dichloro- |
| Synonyms: | Acetaldehyde,dichloro- (6CI,8CI,9CI); 2,2-Dichloroacetaldehyde; Chloroaldehyde;Dichloroacetaldehyde; NSC 5207; a,a-Dichloroacetaldehyde |
| CAS: | 79-02-7 |
| EINECS: | 201-169-5 |
| Molecular Formula: | C2H2 Cl2 O |
| Molecular Weight: | 112.94 |
| InChI: | InChI=1/C2H2Cl2O/c3-2(4)1-5/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1992 |
| Melting Point: | -50 |
| Flash Point: | 60 |
| Boiling Point: | 88 |
| Density: | 1.44 |
| Refractive index: | 1.429 |
| Solubility: | SOL IN ALC Soluble in water and common organic solvents. |
| Specification: |
2,2-Dichloroacetaldehyde (CAS NO.79-02-7) sometimes used obscure names for constituent chemicals .Its extinguishing agent are mist of water, carbon dioxide, sand, foam. Its combustion (decomposition) products are carbon monoxide, carbon dioxide and hydrogen chloride. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 60 |
| Color: | COLORLESS LIQ |
| Safety Data | |
 |
|
