| Identification | |
| Name: | Methyl acetate |
| Synonyms: | Acetic acid methyl ester |
| CAS: | 79-20-9 |
| EINECS: | 201-185-2 |
| Molecular Formula: | C3H6O2 |
| Molecular Weight: | 74.08 |
| InChI: | InChI=1/C3H6O2/c1-3(4)5-2/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1231 |
| Density: | 0.932 |
| Stability: | Stable. Extremely flammable - readily forms explosive mixtures with air. Note low flash point and wide explosion limits. Incompatible with strong oxidizing agents, strong bases, strong acids, nitrates. May be moisture sensitive. |
| Refractive index: | 1.36-1.362 |
| Solubility: | 250 g/l |
| Appearance: | Clear liquid |
| Specification: |
??Methyl acetate (CAS NO.79-20-9), also known as methyl ethanoate or acetic acid methyl ester , is a clear, flammable liquid with a characteristic, not unpleasant smell.? |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS, VOLATILE LIQUID |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
