| Identification | |
| Name: | 2,3-Dimethylbutane |
| Synonyms: | Diisopropyl |
| CAS: | 79-29-8 |
| EINECS: | 201-193-6 |
| Molecular Formula: | C6H14 |
| Molecular Weight: | 86.17 |
| InChI: | InChI=1/C6H14/c1-5(2)6(3)4/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2457 3 |
| Density: | 0.662 |
| Stability: | Stable. Flammable. Readily forms explosive mixtures with air. Note low flash point. Incompatible with strong oxidizing agents, oxygen. |
| Refractive index: | n20/D 1.375(lit.) |
| Solubility: | SOL IN ETHANOL, ETHER; VERY SOL IN ACETONE Water solubility = 22.5 mg/l at 25 deg C |
| Appearance: | clear, colorless liquid |
| Specification: |
2,3-Dimethylbutane is a colourless liquid with CAS Registry Number of 79-29-8. It is an isomer of hexane, also known as 1,1,2,2-Tetramethylethane ; Biisopropyl ; Butane, 2,3-dimethyl- ; CCRIS 6020 ; Diisopropyl ; HSDB 76 ; NSC 24837 ; 2,3-Dimethylbutane [UN2457] [Flammable liquid] ; UN2457 . It is incompatible with strong oxidizing agents. When heated to decomposition, it yields Carbon monoxide , Carbon dioxide . 2,3-Dimethylbutane is used as gas chromatography standard. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
