| Identification | |
| Name: | Dichloroacetyl chloride |
| Synonyms: | - |
| CAS: | 79-36-7 |
| EINECS: | 201-199-9 |
| Molecular Formula: | C2HCl3O |
| Molecular Weight: | 147.39 |
| InChI: | InChI=1/C2HCl3O/c3-1(4)2(5)6/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1765 |
| Melting Point: | < 25 °C |
| Density: | 1.532 |
| Stability: | Stable. Combustible. Incompatible with water, alcohols and oxidizing agents. Fumes in air. |
| Refractive index: | 1.46-1.462 |
| Water Solubility: | MAY DECOMPOSE |
| Solubility: | Water Solubility :MAY DECOMPOSE |
| Appearance: | colourless to light yellow fuming liquid |
| Specification: |
Dichloroacetyl chloride (CAS NO.79-36-7), its Synonyms are 2,2-Dichloroacetyl chloride ; alpha,alpha-Dichloroacetyl chloride ; Chlorid kyseliny dichloroctove ; Chlorure de dichloracetyle ; Acetyl chloride, 2,2-dichloro- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Color: | LIQUID |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
N:Dangerousfortheenvironment
|
 |
|
