| Identification | |
| Name: | Estra-1,3,5(10)-triene-2,4,17-d3-3,16,17-triol,(16a,17b)- (9CI) |
| Synonyms: | 16ALPHA-HYDROXY-17BETA-ESTRADIOL-2,4,17-D3;Estriol-2,4,17-D3;(16a,17)-Estra-1,3,5[10]-triene-3,16,17-triol-d3;Acifemine-d3;Colpogyn-d3;Destriol-d3;Estriol-d3;Ovesterin-d3 |
| CAS: | 79037-36-8 |
| Molecular Formula: | C18H21 D3 O3 |
| Molecular Weight: | 291.4 |
| InChI: | InChI=1/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13?,14-,15?,16?,17+,18+/m1/s1/i3D,8D,17D |
| Molecular Structure: | ![(C18H21D3O3) 16ALPHA-HYDROXY-17BETA-ESTRADIOL-2,4,17-D3;Estriol-2,4,17-D3;(16a,17)-Estra-1,3,5[10]-triene-3,16,17...](https://img1.guidechem.com/chem/e/dict/105/79037-36-8.jpg) |
| Properties | |
| Melting Point: | 284-2860C |
| Flash Point: | 220.828°C |
| Boiling Point: | 469.02°C at 760 mmHg |
| Density: | 1.269g/cm3 |
| Refractive index: | 1.624 |
| Specification: | White Solid usageEng:An estrogenic metabolite considerably less potent than the hormone Estradiol |
| Flash Point: | 220.828°C |
| Storage Temperature: | Refrigerator |
| Usage: | An estrogenic metabolite considerably less potent than the hormone Estradiol |
| Safety Data | |
 |
|
