| Identification | |
| Name: | 1H-Indole-2,3-dione,1-[(3,4-dichlorophenyl)methyl]- |
| Synonyms: | 1-(3,4-Dichlorobenzyl)-1H-indole-2,3-dione |
| CAS: | 79183-19-0 |
| Molecular Formula: | C15H9 Cl2 N O2 |
| Molecular Weight: | 306.14346 |
| InChI: | InChI=1S/C15H9Cl2NO2/c16-11-6-5-9(7-12(11)17)8-18-13-4-2-1-3-10(13)14(19)15(18)20/h1-7H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.494 g/cm3 |
| Refractive index: | 1.671 |
| Water Solubility: | Soluble in DMSO or 100% ethanol. |
| Solubility: | Soluble in DMSO or 100% ethanol. |
| Appearance: | Orange solid |
| Specification: | usageEng:Apoptosis Activator 2 activates caspases in a cytochrome c-dependent manner and induces apoptosis in tumor cells. |
| Biological Activity: | Apoptosis activator; promotes the cytochrome c-dependent oligomerization of Apaf-1 into the mature apoptosome. Increases procaspase-9 processing and subsequent caspase-3 activation. Induces apoptosis in tumor cells (IC 50 = 4-9 μ M for leukaemia cells) with weak or no effect on normal cell lines or those defective/deficient in Apaf-1, caspase-9 or caspase-3 activity (IC 50 > 40 μ M). |
| Storage Temperature: | Store at RT |
| Usage: | Apoptosis Activator 2 activates caspases in a cytochrome c-dependent manner and induces apoptosis in tumor cells. |
| Safety Data | |
 |
|
