| Identification | |
| Name: | N-(4(3,4-dichlorophenyl)-3,4-dihydro-1(2H)naphthalidene) methanamine |
| Synonyms: | 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenimine |
| CAS: | 79560-20-6 |
| Molecular Formula: | C17H15Cl2N |
| Molecular Weight: | 304.22 |
| InChI: | InChI=1/C17H15Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12H,7,9H2,1H3/b20-17+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.251 g/cm3 |
| Refractive index: | 1.619 |
| Solubility: | DMSO: ~26 mg/mL |
| Appearance: | white to light yellow crystal powde |
| Specification: |
4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenimine , with CAS number of 79560-20-6, can be called methanamine, N-[(1E)-4-(3,4-dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenylidene]- ; N-[(1E)-4-(3,4-Dichlorophenyl)-3,4-dihydro-1(2H)-naphthalenylidene]methanamine ; N-[(1E)-4-(3,4-Dichlorphenyl)-3,4-dihydronaphthalen-1(2H)-yliden]methanamin . It is a white to light yellow crystal powde. |
| Color: | white |
| Safety Data | |
 |
|
