| Identification | |
| Name: | Benzene,1-(1-bromo-2,2-diphenylethenyl)-4-chloro- |
| Synonyms: | Ethylene,1-bromo-1-(p-chlorophenyl)-2,2-diphenyl- (7CI,8CI);1-Bromo-1-(p-chlorophenyl)-2,2-diphenylethylene |
| CAS: | 796-13-4 |
| Molecular Formula: | C20H14 Br Cl |
| Molecular Weight: | 369.70 |
| InChI: | InChI=1/C20H14BrCl/c21-20(17-11-13-18(22)14-12-17)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 256.6°C |
| Boiling Point: | 430.3°C at 760 mmHg |
| Density: | 1.381g/cm3 |
| Refractive index: | 1.653 |
| Specification: |
1-Bromo-1-(p-chlorophenyl)-2,2-diphenyl ethylene with cas registry number of 796-13-4 is also known as 1-Bromo-1-(p-chlorophenyl)-2,2-diphenylethylene ; BRN 2533851 ; Ethylene,1-bromo-1-(p-chlorophenyl)-2,2-diphenyl- . It is a reproductive effector that should be stored in a cool, dry place when not in use. It would emit toxic fumes such as bromide and chloride during thermal decomposition. 1-Bromo-1-(p-chlorophenyl)-2,2-diphenyl ethylene with cas registry number of 796-13-4 is used as an intermediate in synthesis of bromide and chloride . |
| Flash Point: | 256.6°C |
| Safety Data | |
 |
|
