| Identification |
| Name: | 1,6,7,8-Indolizinetetrol,octahydro-, (1S,6S,7R,8R,8aR)- |
| Synonyms: | 1,6,7,8-Indolizinetetrol,octahydro-, [1S-(1a,6b,7a,8b,8ab)]-; (+)-Castanospermine;Castanospermine |
| CAS: | 79831-76-8 |
| Molecular Formula: | C8H15 N O4 |
| Molecular Weight: | 189.21 |
| InChI: | InChI=1/C8H15NO4/c10-4-1-2-9-3-5(11)7(12)8(13)6(4)9/h4-8,10-13H,1-3H2/t4-,5?,6+,7+,8?/m0/s1 |
| Molecular Structure: |
![(C8H15NO4) 1,6,7,8-Indolizinetetrol,octahydro-, [1S-(1a,6b,7a,8b,8ab)]-; (+)-Castanospermine;Castanospermine](https://img1.guidechem.com/chem/e/dict/30/79831-76-8.jpg) |
| Properties |
| Melting Point: | 213-217 °C(lit.)
|
| Flash Point: | 267.6°C |
| Boiling Point: | 421.9°C at 760 mmHg |
| Density: | 1.53g/cm3 |
| Refractive index: | 1.647 |
| Biological Activity: | Potent inhibitor of α - and β -glucosidases, especially glucosidase l (required for glucoprotein processing by transfer of mannose and glucose from asparagine-linked lipids). Inhibits HIV syncytium formation and replication. |
| Flash Point: | 267.6°C |
| Storage Temperature: | 2-8°C |
| Usage: | Castanospermine is a plant alkaloid shown to be a potent inhibitor of lysosomal a-or beta- glucosidase. It also inhibits mammalian glucosidase 1 and beta-mannosidase from sweet almonds and fungal beta-xylosidase. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
| |
 |
