| Identification | |
| Name: | Benzene,1-bromo-4-(trans-4-pentylcyclohexyl)- |
| Synonyms: | Benzene,1-bromo-4-(4-pentylcyclohexyl)-, trans-;4-(trans-4-Pentylcyclohexyl)-1-bromobenzene;4-(trans-4-n-Pentylcyclohexyl)phenyl bromide;4-Bromo-1-(trans-4-pentylcyclohexyl)benzene;4-(trans-4-Pentylcyclohexyl)bromobenzene; |
| CAS: | 79832-89-6 |
| Molecular Formula: | C17H25Br |
| Molecular Weight: | 309.28 |
| InChI: | InChI=1/C17H25Br/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(18)13-11-16/h10-15H,2-9H2,1H3/t14-,15- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.129g/cm3 |
| Refractive index: | 1.518 |
| Specification: |
1-Bromo-4-(trans-4-pentylcyclohexyl)benzene , with CAS number of 79832-89-6, can be called 1-Bromo-4-(trans-4-n-pentylcyclohexyl)benzene ; 4-pentyl-cyclohexyl bromo phenol ; 1-bromo-4-(4-pentyl-cyclohexyl)-benzene,5pcbrc17h25br;1-bromo-4-(trans-4-pentylcyclohexyl)benzene ; trans-4-(4-pentylcyclohexyl)-1-bromobenzene . It is an intermediates of liquid crystal. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
