| Identification | |
| Name: | 1,3-Benzenedicarboxaldehyde,2-bromo- |
| Synonyms: | 1-Bromo-2,6-diformylbenzene;2-Bromobenzene-1,3-dialdehyde;2-Bromobenzene-1,3-dicarboxaldehyde;2-Bromoisophthaldehyde; |
| CAS: | 79839-49-9 |
| Molecular Formula: | C8H5BrO2 |
| Molecular Weight: | 213.0281 |
| InChI: | InChI=1/C8H5BrO2/c9-8-6(4-10)2-1-3-7(8)5-11/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.652 g/cm3 |
| Refractive index: | 1.657 |
| Specification: |
The systematic name about this chemical is 2-bromobenzene-1,3-dicarbaldehyde. The CAS register number of 2-Bromobenzene-1,3-dialdehyde is 79839-49-9. It also can be called as 1,3-benzenedicarboxaldehyde, 2-bromo-. Physical properties about 2-Bromobenzene-1,3-dialdehyde are: (1)ACD/LogP: 1.39; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 27; (6)ACD/BCF (pH 7.4): 27; (7)ACD/KOC (pH 5.5): 369; (8)ACD/KOC (pH 7.4): 369; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 34.14Å2; (13)Index of Refraction: 1.657; (14)Molar Refractivity: 47.449 cm3; (15)Molar Volume: 128.95 cm3; (16)Surface Tension: 52.973 dyne/cm; (17)Density: 1.652 g/cm3; (18)Flash Point: 121.394 °C; (19)Enthalpy of Vaporization: 53.791 kJ/mol; (20)Boiling Point: 298.02 °C at 760 mmHg; (21)Vapour Pressure: 0.001 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
