| Identification | |
| Name: | 1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride (1:1),(1R,4S)- |
| Synonyms: | 1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride, (1R,4S)-(9CI); 1-Naphthalenamine, 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-,hydrochloride, (1R-trans)- |
| CAS: | 79896-32-5 |
| Molecular Formula: | C17H17 Cl2 N . Cl H |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H17Cl2N.ClH/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;/h2-6,8,10,12,17,20H,7,9H2,1H3;1H/t12-,17+;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 222.2°C |
| Boiling Point: | 443.8°C at 760 mmHg |
| Specification: | White solid usageEng:Enantiomer 1R,4S of Sertraline. Antidepressant |
| Flash Point: | 222.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | Enantiomer 1R,4S of Sertraline. Antidepressant |
| Safety Data | |
 |
|
