| Identification | |
| Name: | Cyclohexanemethanamine,4-amino-a,a,4-trimethyl- |
| Synonyms: | p-Menthane-1,8-diamine(7CI,8CI); 1,8-Diamino-p-menthane; 1,8-Menthanediamine; 1,8-p-Menthanediamine;1-Amino-1-methyl-4-(2-amino-2-propyl)cyclohexane;1-Methyl-4-(1-amino-1-methylethyl)cyclohexylamine; Menthanediamine; NSC 5612;Primene MD |
| CAS: | 80-52-4 |
| EINECS: | 201-287-7 |
| Molecular Formula: | C10H22 N2 |
| Molecular Weight: | 170.34 |
| InChI: | InChI=1/C10H20.2H3N/c1-8(2)10-6-4-9(3)5-7-10;;/h8-10H,4-7H2,1-3H3;2*1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2922 8 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.4805(lit.) |
| Specification: | dark coloured liquid Safety Statements:26-27-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols | |
 |
|
