| Identification | |
| Name: | Safflower oil |
| Synonyms: | Carthamustinctorius oil;Diestel oil;Diestelol;Distelol;Fats and Glyceridic oils,safflower;Neobee 18;Oils, glyceridic, safflower;Safflower seed oil;Saffola;Thistle oil; |
| CAS: | 8001-23-8 |
| EINECS: | 232-276-5 |
| Molecular Formula: | Unspecified |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C4H7ClOS/c1-2-3-7-4(5)6/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 180kgs |
| Flash Point: | > 110 C |
| Boiling Point: | 155 DEG C |
| Density: | 0.9211 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Thickens and becomes rancid upon prolonged exposure to air. |
| Refractive index: | n20/D 1.476(lit.) |
| Solubility: | Appearance:yellow liquid Transport Information:180kgs Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | yellow liquid |
| Flash Point: | > 110 C |
| Storage Temperature: | Keep tightly closed in a cool place in a tightly closed container. |
| Color: | Amber-colored liquid |
| Usage: | As linseed oil in paints, for salad oil blends, in hydrogenated state as shortening, dietary supplement. |
| Safety Data | |
| Hazard Symbols | |
 |
|
