| Identification | |
| Name: | ammonium nitrate - 2-methyl-1,3,5-trinitrobenzene (1:1:1) |
| Synonyms: | 8006-19-7;Akvatol;Ifzanit;Amatol;Gabrovit ZhV;GL (explosive);Rock No. 2;AC1L2NLJ;NITRIC ACID AMMONIUM SALT, mixt. with 2-METHYL-1,3,5-TRINITROBENZENE;Ammonium nitrate mixture with trinitrotoluene;azanium 2-methyl-1,3,5-trinitrobenzene nitrate;ammonium nitrate - 2-methyl-1,3,5-trinitrobenzene (1:1:1);GL |
| CAS: | 8006-19-7 |
| Molecular Formula: | C7H9N5O9 |
| Molecular Weight: | 307.1745 |
| InChI: | InChI=1/C7H5N3O6.NO3.H3N/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16;2-1(3)4;/h2-3H,1H3;;1H3/q;-1;/p+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 167.1°C |
| Boiling Point: | 339.2°C at 760 mmHg |
| Flash Point: | 167.1°C |
| Safety Data | |
 |
|
