| Identification | |
| Name: | Kerosene |
| Synonyms: | Kerosine;Kerosine (petroleum); AF 100 (pesticide); Avtur; Avtur (pesticide); Bayol 35;Bitumen Cutter; Chiotekku; Chiotekku SH; Coal oil; Conoco 170E; Deotomisol S;Eneos Kerosene; Escaid 100; Escaid 110; Exxsol D 200/240; Finalan 75; Fuels,kerosine; Ink oil; KO 30 (solvent); Kedrul 212; Magisol 52; Neochiozol;Nysolvin 75A; Odorless Solvent 3440; P 878; Parasol; Pegasol 3040; RP 3; RP 3(solvent); SX 12; SX 7; Shell 140; Shellsol 2046; Solbrax Eco 255/285;W-Kerosene |
| CAS: | 8008-20-6 |
| EINECS: | 232-366-4 |
| Molecular Formula: | C15H32 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C15H32/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h15H,4-14H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1223 |
| Melting Point: | < -48 C |
| Flash Point: | 35 - 65 C depending upon composition |
| Density: | 0.8 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.436 |
| Solubility: | insoluble
|
| Appearance: | yellow liquid |
| Specification: | yellow liquid Safety Statements:23-24-62-61-36/37 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24:Avoid contact with skin 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label 61:Avoid release to the environment. Refer to special instructions safety data sheet 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| Flash Point: | 35 - 65 C depending upon composition |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
