| Identification | |
| Name: | Donovan's solution(8CI) |
| Synonyms: | Arsenic andmercuric iodides solution |
| CAS: | 8012-54-2 |
| Molecular Formula: | AsHgI4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/AsI3.Hg.HI/c2-1(3)4;;/h;;1H/q;+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 403°C at 760 mmHg |
| Specification: |
Arsenic triiodide mixed with mercuric iodide ,its CAS number is 8012-54-2,it can be called Mercuric iodide mixed with arsenic triiodide and Donovan's solution . Arsenic triiodide mixed with mercuric iodide (CAS NO. 8012-54-2) is a moderately toxic substance,with flammability, burning will produce toxic mercury vapor, smoke, arsenic and iodide,so it should be stored in cool and dry environment,separate from food and materials,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Report: |
Arsenic compounds and Mercury compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
