| Identification | |
| Name: | 5-Bromo-7-nitroindoline |
| Synonyms: | 5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
| CAS: | 80166-90-1 |
| EINECS: | 279-411-4 |
| Molecular Formula: | C8H7BrN2O2 |
| Molecular Weight: | 243.05738 |
| InChI: | InChI=1S/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.704 g/cm3 |
| Refractive index: | 1.64 |
| Water Solubility: | Insoluble in water. Soluble in methanol. |
| Solubility: | Insoluble in water. Soluble in methanol. |
| Appearance: | Light yellow crystals |
| Specification: | Orange to brown solid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
