| Identification | |
| Name: | Amyl nitrite mixture |
| Synonyms: | Nitrous acid, 2-methylbutyl ester, mixt. with 3-methylbutylnitrite;Amyl nitrite mixture;AC1L2NLU;Amyl nitrite [USAN:JAN];UNII-22T8Z09XAK;LS-187037;2-methylbutyl nitrite; 3-methylbutyl nitrite;A mixture of nitrous acid, 2-methylbutyl ester, and nitrous acid, 3-methylbutyl ester |
| CAS: | 8017-89-8 |
| Molecular Formula: | C10H22N2O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/2C5H11NO2/c1-5(2)3-4-8-6-7;1-3-5(2)4-8-6-7/h2*5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 10°C |
| Boiling Point: | 99.1°C at 760 mmHg |
| Flash Point: | 10°C |
| Safety Data | |
 |
|
