| Identification | |
| Name: | Creosote, wood |
| Synonyms: | Beechwoodcreosote; Creasote; Creosote beechwood; Wood creosote |
| CAS: | 8021-39-4 |
| EINECS: | 232-419-1 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.13722 |
| InChI: | InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 30kgs |
| Melting Point: | -20 |
| Flash Point: | 74 °C |
| Boiling Point: | 200 - 240 C |
| Density: | 1.09 g/mL at 20 °C |
| Refractive index: | 1.534 |
| Water Solubility: | 0.1-1 g/100ml at 23 C (But Soluble in methanol, acetone) |
| Solubility: | 0.1-1 g/100ml at 23 C (But Soluble in methanol, acetone) |
| Appearance: | Colorless to yellowish oily liquid |
| Specification: |
Beechwood cresoate ,its CAS NO. is 8021-39-4,the synonyms is Beechwood creosote ; Creosote ; Creosote coal tar ; Coal tar creosote ; Beechwoodcresoate ; Creasote ; Creosote,beechwood ; Creosote,wood . |
| Report: |
NTP 10th Report on Carcinogens. Reported in EPA TSCA Inventory. |
| Flash Point: | 74 °C |
| Color: | Faintly yellowish, limpid, oily liquid or yellow crystals White or slightly yellow crystalline mass or colorless to yellowish, very refractive liquid Hexagonal prisms |
| Safety Data | |
| Hazard Symbols |
8
(Packing Group: II)
UN
NO.
|
 |
|
