| Identification | |
| Name: | 1H-Imidazole-5-methanol,1-(phenylmethyl)- |
| Synonyms: | 1-Benzyl-5-(hydroxymethyl)imidazole;1-Benzyl-5-hydroxymethyl-1H-imidazole |
| CAS: | 80304-50-3 |
| Molecular Formula: | C11H12 N2 O |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C11H12N2O/c14-8-11-6-12-9-13(11)7-10-4-2-1-3-5-10/h1-6,9,14H,7-8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.13g/cm3 |
| Refractive index: | 1.592 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
