| Identification | |
| Name: | 3,3',4,4'-TETRACHLOROBIPHENYL-UL-14C |
| Synonyms: | 3,3',4,4'-TETRACHLOROBIPHENYL-UL-14C;1,1'-Biphenyl, 3,3',4,4'-tetrachloro-, labeled with carbon-14;3,3',4,4'-Tetrachloro(14C-U)biphenyl;3,3',4,4'-Tetrachloro-1,1'-biphenyl labeled with carbon-14 |
| CAS: | 80333-65-9 |
| Molecular Formula: | C12H6Cl4 |
| Molecular Weight: | 316.2 |
| InChI: | InChI=1/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1294 3/PG 2 |
| Melting Point: | 182-184 DEG C |
| Flash Point: | 188.4°C |
| Boiling Point: | 380.7°C at 760 mmHg |
| Density: | 1.441g/cm3 |
| Refractive index: | 1.612 |
| Solubility: | 18.0X10-2 MG/L WATER |
| Specification: | Safety Statements:36/37-46-62 36/37:Wear suitable protective clothing and gloves 46:If swallowed, seek medical advice immediately and show this container or label 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Flash Point: | 188.4°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
