| Identification | |
| Name: | 4-Ethynyl-4'-pentyl-1,1'-biphenyl |
| Synonyms: | 1,1'-biphenyl, 4-ethynyl-4'-pentyl-; |
| CAS: | 80563-43-5 |
| Molecular Formula: | C19H20 |
| Molecular Weight: | 248.36 |
| InChI: | InChI=1/C19H20/c1-3-5-6-7-17-10-14-19(15-11-17)18-12-8-16(4-2)9-13-18/h2,8-15H,3,5-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.9°C |
| Boiling Point: | 363.2°C at 760 mmHg |
| Density: | 0.99g/cm3 |
| Refractive index: | 1.569 |
| Specification: |
The 4-Ethynyl-4'-pentyl-1,1'-biphenyl with the CAS number 80563-43-5 is also called 1,1'-biphenyl, 4-ethynyl-4'-pentyl-. The systematic name is 4-ethynyl-4'-pentylbiphenyl. Its molecular formula is C19H20. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP:6.74; (2)# of Rule of 5 Violations:1 ; (3)#H bond acceptors:0; (4)#H bond donors:0; (5)#Freely Rotating Bonds:5; (6)Polar Surface Area:0 Å2; (7)Index of Refraction:1.569; (8)Molar Refractivity:81.66 cm3; (9)Molar Volume:248.9 cm3; (10)Polarizability:32.37×10-24cm3; (11)Surface Tension:41.9 dyne/cm; (12)Enthalpy of Vaporization:58.53 kJ/mol; (13)Vapour Pressure:3.83×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 168.9°C |
| Safety Data | |
 |
|
