| Identification | |
| Name: | Tselatox |
| Synonyms: | TSLT;Celatox;Tselatox;8064-18-4;Acetic acid, (4-chloro-2-methylphenoxy)-, butyl ester, mixt. with pentyl (2,4,5-trichlorophenoxy)acetate;AC1L2NMI;LS-11315;butyl (4-chloro-2-methylphenoxy)acetate - pentyl (2,4,5-trichlorophenoxy)acetate (1:1);butyl 2-(4-chloro-2-methylphenoxy)acetate; pentyl 2-(2,4,5-trichlorophenoxy)acetate |
| CAS: | 8064-18-4 |
| Molecular Formula: | C13H17ClO3 . C13H15Cl3O3 |
| Molecular Weight: | 582.3407 |
| InChI: | InChI=1/C13H15Cl3O3.C13H17ClO3/c1-2-3-4-5-18-13(17)8-19-12-7-10(15)9(14)6-11(12)16;1-3-4-7-16-13(15)9-17-12-6-5-11(14)8-10(12)2/h6-7H,2-5,8H2,1H3;5-6,8H,3-4,7,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.7°C |
| Boiling Point: | 385.8°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Tselatox ,its CAS NO. is 8064-18-4,the synonyms is Celatox ; TSLT ; Acetic acid, (4-chloro-2-methylphenoxy)-, butyl ester, mixt. with pentyl (2,4,5-trichlorophenoxy)acetate . |
| Flash Point: | 143.7°C |
| Safety Data | |
 |
|
