| Identification | |
| Name: | 17alpha-Hydroxytrenbolone |
| Synonyms: | 17alpha-Hydroxytrenbolone |
| CAS: | 80657-17-6 |
| Molecular Formula: | C18H22O2 |
| Molecular Weight: | 270.37 |
| InChI: | InChI=1/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h8-10,15-17,20H,2-7H2,1H3/t15-,16+,17-,18+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208.2°C |
| Boiling Point: | 490.8°C at 760 mmHg |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.605 |
| Specification: | Pale Brown Solid usageEng:Controlled substance (anabolic steroid). A prohormone of Trenbolone (T719000). |
| Flash Point: | 208.2°C |
| Storage Temperature: | Controlled Substance, -20?C Freezer |
| Usage: | Controlled substance (anabolic steroid). A prohormone of Trenbolone (T719000). |
| Safety Data | |
 |
|
