| Identification | |
| Name: | Ametryne-2,4-D mixt. |
| Synonyms: | Gesapax multi;Gesapax-H;A 3615;A 5071A;A 5072A;8073-61-8;Acetic acid, (2,4-dichlorophenoxy)-, mixt. with N-ethyl-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine;Ametryne-2,4-D mixt;Ametryne-2,4-D mixt.;AC1L2NN1;LS-11630;(2,4-dichlorophenoxy)acetic acid - N-ethyl-6-(methylsulfanyl)-N'-(propan-2-yl)-1,3,5-triazine-2,4-diamine (1:1);2-(2,4-dichlorophenoxy)acetic acid; 4-N-ethyl-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| CAS: | 8073-61-8 |
| Molecular Formula: | C9H17N5S . C8H6Cl2O3 |
| Molecular Weight: | 448.3672 |
| InChI: | InChI=1/C9H17N5S.C8H6Cl2O3/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4;9-5-1-2-7(6(10)3-5)13-4-8(11)12/h6H,5H2,1-4H3,(H2,10,11,12,13,14);1-3H,4H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 193.5°C |
| Boiling Point: | 396.4°C at 760 mmHg |
| Specification: |
Ametryne-2,4-D mixt. , its cas register number is 8073-61-8. It also can be called Gesapax multi ; Gesapax-H ; and Acetic acid, (2,4-dichlorophenoxy)-, mixt. with N-ethyl-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine . Its classification code Agricultural Chemical and Herbicide. |
| Flash Point: | 193.5°C |
| Safety Data | |
 |
|
