Identification |
Name: | diferric; benzo[a]pyrene; oxygen(-2) anion |
Synonyms: | AC1L4X4I;Benzo(a)pyrene, mixt. with iron oxide (Fe2-O3);AR-1I5186;benzo[a]pyrene; iron(3+); oxygen(2-);diferric; benzo[a]pyrene; oxygen(-2) anion |
CAS: | 8076-07-1 |
Molecular Formula: | C20H12Fe2O3 |
Molecular Weight: | 411.9975 |
InChI: | InChI=1/C20H12.2Fe.3O/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14;;;;;/h1-12H;;;;;/q;2*+3;3*-2 |
Molecular Structure: |
![(C20H12Fe2O3) AC1L4X4I;Benzo(a)pyrene, mixt. with iron oxide (Fe2-O3);AR-1I5186;benzo[a]pyrene; iron(3+); oxygen(2...](https://img.guidechem.com/pic/image/8076-07-1.png) |
Properties |
Flash Point: | 228.6°C |
Boiling Point: | 495°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 228.6°C |
Safety Data |
|
![](/images/detail_15.png) |