Identification |
Name: | 2-O-Benzyl-1,3,4,6-tetra-O-acetyl-a-D-mannopyranose |
Synonyms: | 1,3,4,6-Tetra-O-acetyl-2-O-benzyl-a-D-mannopyranose |
CAS: | 80779-87-9 |
Molecular Formula: | C20H27O10 |
Molecular Weight: | 0 |
InChI: | InChI=1/C21H26O10/c1-12(22)26-11-17-18(28-13(2)23)19(29-14(3)24)20(21(31-17)30-15(4)25)27-10-16-8-6-5-7-9-16/h5-9,17-21H,10-11H2,1-4H3/t17?,18-,19+,20-,21+/m1/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 221.178°C |
Boiling Point: | 514.203°C at 760 mmHg |
Density: | 1.276g/cm3 |
Refractive index: | 1.523 |
Flash Point: | 221.178°C |
Usage: | Used for the preparation of the corresponding bromide, to be used as an agent for the preparation of -mannosides |
Safety Data |
|
 |