| Identification | |
| Name: | 9,10-Anthracenedione,1-amino-2,4-dibromo- |
| Synonyms: | Anthraquinone,1-amino-2,4-dibromo- (6CI,7CI,8CI);1-Amino-2,4-dibromo-9,10-anthraquinone;2,4-Dibromo-1-anthraquinonylamine;NSC 3529; |
| CAS: | 81-49-2 |
| EINECS: | 201-354-0 |
| Molecular Formula: | C14H7Br2NO2 |
| Molecular Weight: | 381.02 |
| InChI: | InChI=1/C14H7Br2NO2/c15-8-5-9(16)12(17)11-10(8)13(18)6-3-1-2-4-7(6)14(11)19/h1-5H,17H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.966 g/cm3 |
| Stability: | Stable. |
| Refractive index: | 1.742 |
| Water Solubility: | < 0.1 g/100 ml at 23 C SOLVENT |
| Solubility: | < 0.1 g/100 ml at 23 C SOLVENT < AUTOIGNITION |
| Appearance: | red powder |
| Specification: |
The chemical synonyms of 1-Amino-2,4-dibromoanthracene-9,10-dione (81-49-2) are 1-Amino-2,4-dibromanthrachinon ; 1-amino-2,4-dibromanthrachinon(czech) ; 1-amino-2,4-dibromo-10-anthracenedione ; 1-Amino-2,4-dibromoanthra-9,10-quinone ; 1-amino-2,4-dibromo-anthraquinon ; 9,10-Anthracenedione, 1-amino-2,4-dibromo- ; Anthraquinone, 1-amino-2,4-dibromo- . 1-Amino-2,4-dibromoanthraquinone (81-49-2) is probably combustible.It can be used as pharmaceutical intermediate and intermediate. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Red needles (from xylene) |
| Usage: | Aminoanthraquinones are key products for essentially all classes of anthraquinone dyes. Aminoanthraquinones. |
| Safety Data | |
| Hazard Symbols | |
 |
|
