| Identification | |
| Name: | 9,10-Anthracenedione,1,4,5,8-tetrachloro- |
| Synonyms: | Anthraquinone,1,4,5,8-tetrachloro- (6CI,7CI,8CI); 1,4,5,8-Tetrachloro-9,10-anthracenedione;1,4,5,8-Tetrachloro-9,10-anthraquinone; 1,4,5,8-Tetrachloroanthraquinone; NSC513487 |
| CAS: | 81-58-3 |
| EINECS: | 201-362-4 |
| Molecular Formula: | C14H4 Cl4 O2 |
| Molecular Weight: | 345.99 |
| InChI: | InChI=1/C14H4Cl4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -9 |
| Flash Point: | 213.5 ºC |
| Boiling Point: | 510.7 ºC at 760 mmHg |
| Density: | 1.672 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.250 (20 C) |
| Solubility: | Slightly soluble |
| Appearance: | Clear, colorless liquid. |
| Specification: |
1,4,5,8-Tetrachloroanthraquinone , its cas register number is 81-58-3. It also can be called 1,4,5,8-Tetrachloro-9,10-anthraquinone ; NSC 513487 . |
| Packinggroup: | I; II; III |
| Flash Point: | 213.5 ºC |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
 |
|
