| Identification | |
| Name: | 1,8-Naphthalimide |
| Synonyms: | naphthalene-1,8-dicarboximide |
| CAS: | 81-83-4 |
| EINECS: | 201-379-7 |
| Molecular Formula: | C12H7NO2 |
| Molecular Weight: | 197.19 |
| InChI: | InChI=1/C12H7NO2/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11/h1-6H,(H,13,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208.9 ºC |
| Boiling Point: | 449.1 ºC at 760 mmHg |
| Density: | 1.391 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.696 |
| Appearance: | off-white to white powder |
| Specification: |
1H-Benz(de)isoquinoline-1,3(2H)-dione (CAS NO.81-83-4), its Synonyms are 1,8-Naphthalenedicarboximide ; 1,8-Naphthalimide ; Naphthalene-1,8-dicarboximide ; Naphthalimide (8CI) ; Benzo[de]isoquinoline-1,3(1H,3H)-dione . It is off-white to white powder. |
| Flash Point: | 208.9 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Useful material for utilization in phosphorescence dye doped organic light emitting diodes (oleds), as hole-blocking and electron-conducting material. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
