Identification |
Name: | Phosphinous chloride,dimethyl- (6CI,7CI,8CI,9CI) |
Synonyms: | Chlorodimethylphosphine;Dimethylchlorophosphine; Dimethylphosphine chloride; Dimethylphosphinouschloride |
CAS: | 811-62-1 |
EINECS: | 212-372-3 |
Molecular Formula: | C2H6 Cl P |
Molecular Weight: | 96.49 |
InChI: | InChI=1/C2H6ClP/c1-4(2)3/h1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | 2845 |
Density: | 1.22 |
Water Solubility: | reacts violently with water |
Solubility: | reacts violently with water |
Appearance: | colorless to pale yellow liq. |
Packinggroup: | I |
Sensitive: | Air & Moisture Sensitive |
Safety Data |
|
 |