| Identification | |
| Name: | Glycine,N-[2-[(acetylthio)methyl]-1-oxo-3-phenylpropyl]-, methyl ester |
| CAS: | 81110-05-6 |
| Molecular Formula: | C15H19 N O4 S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H19NO4S/c1-11(17)21-10-13(8-12-6-4-3-5-7-12)15(19)16-9-14(18)20-2/h3-7,13H,8-10H2,1-2H3,(H,16,19) |
| Molecular Structure: | ![(C15H19NO4S) Glycine,N-[2-[(acetylthio)methyl]-1-oxo-3-phenylpropyl]-, methyl ester, (?à)-](https://img1.guidechem.com/chem/e/dict/122/81110-05-6.jpg) |
| Properties | |
| Flash Point: | 248.4°C |
| Boiling Point: | 487.1°C at 760 mmHg |
| Density: | 1.195g/cm3 |
| Refractive index: | 1.543 |
| Flash Point: | 248.4°C |
| Usage: | Intermediate for the synthesis of Thiorphan |
| Safety Data | |
 |
|
