| Identification | |
| Name: | (+/-)14,15-EPOXYEICOSA-5Z,8Z,11Z-TRIENOIC ACID |
| Synonyms: | (+/-)14,15-EPOXYEICOSA-5Z,8Z,11Z-TRIENOIC ACID;(+/-)14,15-EET;14,15-EET;(+/-)14(15)-EPETRE;14(15)-EPETRE;(+/-)14(15)-EPOXY-5Z,8Z,11Z-EICOSATRIENOIC ACID;14,15-epoxy-5,8,11-eicosatrienoicacid;(5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoic acid |
| CAS: | 81276-03-1 |
| Molecular Formula: | C20H32O3 |
| Molecular Weight: | 320.47 |
| InChI: | InChI=1/C20H32O3/c1-2-3-12-15-18-19(23-18)16-13-10-8-6-4-5-7-9-11-14-17-20(21)22/h4,6-7,9-10,13,18-19H,2-3,5,8,11-12,14-17H2,1H3,(H,21,22)/b6-4+,9-7+,13-10+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1170 3/PG 2 |
| Flash Point: | 155.7°C |
| Boiling Point: | 464.5°C at 760 mmHg |
| Density: | 0.983g/cm3 |
| Refractive index: | 1.501 |
| Specification: | Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 155.7°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
